CAS 1393441-77-4: 4-Bromo-5-chloro-2-(2-methoxyethoxy)benzenamine

Description:4-Bromo-5-chloro-2-(2-methoxyethoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom at the 4-position, a chlorine atom at the 5-position, and an amino group at the 2-position. The presence of the 2-(2-methoxyethoxy) substituent introduces an ether functionality, contributing to the compound's solubility and reactivity. This compound is likely to exhibit moderate polarity due to the combination of halogen and ether groups, which can influence its interactions in various chemical environments. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such substitutions can enhance biological activity or selectivity. Additionally, the presence of halogens may impart unique properties such as increased stability or altered electronic characteristics. Safety and handling considerations should be taken into account, as halogenated compounds can pose environmental and health risks. Overall, 4-Bromo-5-chloro-2-(2-methoxyethoxy)benzenamine is a complex molecule with diverse potential applications in chemical synthesis and research.

Formula:C₉H₁₁BrClNO₂

InChI:InChI=1S/C9H11BrClNO2/c1-13-2-3-14-9-4-6(10)7(11)5-8(9)12/h4-5H,2-3,12H2,1H3

InChI key:InChIKey=QZKLYPSJSIMELL-UHFFFAOYSA-N

SMILES:ClC=1C=C(N)C(OCCOC)=CC1Br