CAS 139346-57-9
:N-succinimidyl 7-(diethylamino)coumarin-3-carboxylate
Description:
N-succinimidyl 7-(diethylamino)coumarin-3-carboxylate is a fluorescent dye commonly used in bioconjugation and labeling applications due to its reactive succinimidyl group, which facilitates the formation of stable amide bonds with primary amines in proteins or other biomolecules. This compound features a coumarin backbone, which is known for its strong fluorescence properties, making it suitable for various imaging techniques. The diethylamino group enhances its solubility in organic solvents and biological media, while the carboxylate moiety contributes to its reactivity and potential for further functionalization. The compound is typically characterized by its absorption and emission spectra, which are crucial for applications in fluorescence microscopy and flow cytometry. Additionally, it is important to handle this substance with care, as it may pose hazards typical of reactive chemical compounds, including potential toxicity and reactivity with biological materials. Overall, N-succinimidyl 7-(diethylamino)coumarin-3-carboxylate is a valuable tool in chemical biology for studying protein interactions and dynamics.
Formula:C18H18N2O6
InChI:InChI=1/C18H18N2O6/c1-3-19(4-2)12-6-5-11-9-13(17(23)25-14(11)10-12)18(24)26-20-15(21)7-8-16(20)22/h5-6,9-10H,3-4,7-8H2,1-2H3
SMILES:CCN(CC)c1ccc2cc(c(=O)oc2c1)C(=O)ON1C(=O)CCC1=O
Synonyms:- 7-(Diethylamino)coumarin-3-carboxylicacid-N-succinimidylester
- 1-({[7-(diethylamino)-2-oxo-2H-chromen-3-yl]carbonyl}oxy)pyrrolidine-2,5-dione
- 7-(N,N-diethylamino)coumarin-3-carboxylic acid succinimidyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
N-Succinimidyl 7-(Diethylamino)coumarin-3-carboxylate
CAS:Formula:C18H18N2O6Purity:>98.0%(HPLC)Color and Shape:Light yellow to Yellow to Green powder to crystalMolecular weight:358.352,5-Dioxopyrrolidin-1-Yl7-(Diethylamino)-2-Oxo-2H-Chromene-3-Carboxylate
CAS:2,5-Dioxopyrrolidin-1-Yl7-(Diethylamino)-2-Oxo-2H-Chromene-3-CarboxylatePurity:99%Molecular weight:358.35g/molDEAC, SE
CAS:<p>DEAC, SE (7-Diethylaminocoumarin-3-carboxy acid) is a blue fluorescent dye for labeling amine-containing organisms. λex of DEAC, SE is 330 nm and λem is 402</p>Formula:C18H18N2O6Purity:98.2%Color and Shape:SolidMolecular weight:358.35Succinimidyl 7-diethylaminocoumarin-3-carboxylate
CAS:Formula:C18H18N2O6Purity:98%Molecular weight:358.357-(Diethylamino)coumarin-3-carboxylic Acid N-Succinimidyl Ester
CAS:Controlled ProductFormula:C18H18N2O6Color and Shape:NeatMolecular weight:358.35






