CymitQuimica logo

CAS 139356-33-5

:

Methyl (3S,5S)-3,5-bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]-1-hydroxycyclohexanecarboxylate

Description:
Methyl (3S,5S)-3,5-bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]-1-hydroxycyclohexanecarboxylate is a chemical compound characterized by its complex structure, which includes a cyclohexane ring substituted with various functional groups. The presence of silyl ether groups indicates that it has enhanced stability and hydrophobic properties, making it useful in various applications, including organic synthesis and as a protective group in chemical reactions. The stereochemistry denoted by (3S,5S) suggests specific spatial arrangements of atoms, which can influence the compound's reactivity and interactions with biological systems. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such modifications can enhance bioavailability or target specificity. As with many organosilicon compounds, it may exhibit unique properties such as thermal stability and resistance to moisture, making it valuable in various industrial applications.
Formula:C20H42O5Si2
InChI:InChI=1S/C20H42O5Si2/c1-18(2,3)26(8,9)24-15-12-16(25-27(10,11)19(4,5)6)14-20(22,13-15)17(21)23-7/h15-16,22H,12-14H2,1-11H3/t15-,16-/m0/s1
InChI key:InChIKey=WNYWWPLFOPIFQS-HOTGVXAUSA-N
SMILES:C(OC)(=O)[C@]1(O)C[C@@H](O[Si](C(C)(C)C)(C)C)C[C@H](O[Si](C(C)(C)C)(C)C)C1
Synonyms:
  • Cyclohexanecarboxylic acid, 3,5-bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]-1-hydroxy-, methyl ester, (3S,5S)-
  • Methyl (3S,5S)-3,5-bis[[(1,1-dimethylethyl)dimethylsilyl]oxy]-1-hydroxycyclohexanecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.