CymitQuimica logo

CAS 1393574-65-6

:

Pyridine, 6-(chloromethyl)-3-fluoro-2-methyl-

Description:
Pyridine, 6-(chloromethyl)-3-fluoro-2-methyl- is a heterocyclic organic compound characterized by a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This specific compound features a chloromethyl group and a fluorine atom at designated positions on the ring, contributing to its reactivity and potential applications in organic synthesis. The presence of the chloromethyl group makes it a useful intermediate in the synthesis of various pharmaceuticals and agrochemicals, while the fluorine atom can enhance the compound's biological activity and lipophilicity. Pyridine derivatives are known for their diverse chemical properties, including basicity and nucleophilicity, which can be influenced by the substituents on the ring. This compound may exhibit specific physical properties such as solubility in organic solvents and distinct melting or boiling points, which are essential for its handling and application in laboratory settings. As with many pyridine derivatives, safety precautions should be taken due to potential toxicity and environmental impact.
Formula:C7H7ClFN
InChI:InChI=1S/C7H7ClFN/c1-5-7(9)3-2-6(4-8)10-5/h2-3H,4H2,1H3
InChI key:InChIKey=DCFWMXRLELAHFC-UHFFFAOYSA-N
SMILES:C(Cl)C=1N=C(C)C(F)=CC1
Synonyms:
  • 6-(Chloromethyl)-3-fluoro-2-methylpyridine
  • Pyridine, 6-(chloromethyl)-3-fluoro-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.