CAS 139369-42-9
:4-chloro-5-(2,3-dichlorophenoxy)-1,2-Benzenediamine
Description:
4-Chloro-5-(2,3-dichlorophenoxy)-1,2-benzenediamine, with CAS number 139369-42-9, is an organic compound characterized by its complex aromatic structure, which includes a benzene ring substituted with both amino groups and chlorinated phenoxy groups. This compound typically exhibits properties associated with aromatic amines, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of multiple chlorine atoms contributes to its hydrophobic characteristics and may influence its reactivity, particularly in electrophilic substitution reactions. Additionally, the compound may exhibit biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. However, due to the presence of chlorine and amino groups, it may also pose environmental and health risks, necessitating careful handling and assessment of its toxicity. Overall, 4-chloro-5-(2,3-dichlorophenoxy)-1,2-benzenediamine is a notable compound in chemical research, particularly in studies related to its synthesis, reactivity, and potential applications.
Formula:C12H9Cl3N2O
InChI:InChI=1/C12H9Cl3N2O/c13-6-2-1-3-10(12(6)15)18-11-5-9(17)8(16)4-7(11)14/h1-5H,16-17H2
SMILES:c1cc(c(c(c1)Oc1cc(c(cc1Cl)N)N)Cl)Cl
Synonyms:- 4-Chloro-5-(2,3-Dichlorophenoxy)Benzene-1,2-Diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1,2-Benzenediamine, 4-chloro-5-(2,3-dichlorophenoxy)-
CAS:Formula:C12H9Cl3N2OMolecular weight:303.57174-Chloro-5-(2,3-dichlorophenoxy)-1,2-benzenediamine
CAS:Controlled ProductApplications 4-Chloro-5-(2,3-dichlorophenoxy)-1,2-benzenediamine is an intermediate in the synthesis of 5-Chloro-6-(2,3-dichlorophenoxy)-1,3-dihydro-2H-benzimidazol-2-one (C365505), which is a metabolite of Triclabendazole (T774175), the only anthelmintic drug, which is active against immature, mature and adult stages of fluke.
References Whelan, M., et al.: J. Chromato., 1275, 41 (2013); Barrera, S., et al.; Antimicrob. Agent. Chemother., 56, 3535 (2012);Formula:C12H9Cl3N2OColor and Shape:NeatMolecular weight:303.572

