CAS 139370-58-4
:L-Proline, 1-L-glutaminyl-
Description:
L-Proline, 1-L-glutaminyl- is a dipeptide composed of the amino acids L-proline and L-glutamine. It is characterized by its unique structure, which includes a cyclic structure from proline that contributes to its stability and potential biological activity. This compound is often studied for its role in protein synthesis and its involvement in various metabolic processes. L-Proline is known for its role in collagen formation and cellular functions, while L-glutamine is crucial for nitrogen transport and metabolism in the body. The combination of these two amino acids may enhance their individual properties, potentially influencing cellular signaling and stress responses. L-Proline, 1-L-glutaminyl- may also exhibit antioxidant properties and support immune function. As a dipeptide, it is soluble in water and may be utilized in various biochemical applications, including research and therapeutic contexts. Its CAS number, 139370-58-4, is a unique identifier that facilitates its recognition in scientific literature and databases.
Formula:C10H17N3O4
InChI:InChI=1S/C10H17N3O4/c11-6(3-4-8(12)14)9(15)13-5-1-2-7(13)10(16)17/h6-7H,1-5,11H2,(H2,12,14)(H,16,17)/t6-,7-/m0/s1
InChI key:InChIKey=NJMYZEJORPYOTO-BQBZGAKWSA-N
SMILES:C([C@H](CCC(N)=O)N)(=O)N1[C@H](C(O)=O)CCC1
Synonyms:- 41: PN: WO2005081628 SEQID: 1041 claimed protein
- 89: PN: WO2011146121 PAGE: 115 claimed sequence
- L-Proline, L-glutaminyl-
- L-Glutaminyl-L-proline
- L-Proline, 1-L-glutaminyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
