CymitQuimica logo

CAS 1393845-70-9

:

N-(3-Iodo-8-quinolinyl)acetamide

Description:
N-(3-Iodo-8-quinolinyl)acetamide is a chemical compound characterized by its unique structure, which includes a quinoline moiety substituted with an iodine atom and an acetamide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the quinoline ring, which is known for its pharmacological significance. The iodine substitution can influence the compound's reactivity and solubility, potentially enhancing its lipophilicity. N-(3-Iodo-8-quinolinyl)acetamide may also display specific interactions with biological targets, making it of interest in medicinal chemistry. Its molecular weight, melting point, and solubility characteristics would depend on the specific conditions and purity of the sample. As with many quinoline derivatives, this compound may be investigated for its potential applications in drug development, particularly in the fields of antimicrobial or anticancer research. Safety and handling precautions should be observed due to the presence of iodine and the potential biological activity of the compound.
Formula:C11H9IN2O
InChI:InChI=1S/C11H9IN2O/c1-7(15)14-10-4-2-3-8-5-9(12)6-13-11(8)10/h2-6H,1H3,(H,14,15)
InChI key:InChIKey=GHGQOWJMGOYLPH-UHFFFAOYSA-N
SMILES:N(C(C)=O)C=1C2=C(C=C(I)C=N2)C=CC1
Synonyms:
  • N-(3-Iodo-8-quinolinyl)acetamide
  • Acetamide, N-(3-iodo-8-quinolinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.