CAS 139399-67-0

3-Bromo-8-quinolinamine

Description:

3-Bromo-8-quinolinamine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 3-position and an amino group at the 8-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its aromatic nature. It is often used in medicinal chemistry and research due to its potential biological activity, including antimicrobial and anticancer properties. The bromine substituent can enhance reactivity, making it a useful intermediate in various synthetic applications. Additionally, the amino group can participate in hydrogen bonding, influencing its interactions in biological systems. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 3-Bromo-8-quinolinamine serves as a valuable compound in both synthetic and pharmaceutical chemistry contexts.

Formula: C₉H₇BrN₂

InChI: InChI=1S/C9H7BrN2/c10-7-4-6-2-1-3-8(11)9(6)12-5-7/h1-5H,11H2

InChI key: InChIKey=NDROWMOVSVLHDO-UHFFFAOYSA-N

SMILES: NC=1C2=C(C=C(Br)C=N2)C=CC1

Synonyms:

• (3-Bromoquinolin-8-yl)amine
• 3-Bromo-8-aminoquinoline
• 3-Bromo-8-quinolinamine
• 3-Bromoquinolin-8-amine
• 8-Amino-3-bromoquinoline
• 8-Quinolinamine, 3-bromo-

8-Quinolinamine, 3-bromo-

CAS: 139399-67-0

Formula: C₉H₇BrN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 223.0693

Ref: IN-DA001AXG

3-Bromoquinolin-8-amine

CAS: 139399-67-0

3-Bromoquinolin-8-amine

Purity: 98%

Molecular weight: 223.07g/mol

Ref: 54-OR76730

3-Bromoquinolin-8-amine

CAS: 139399-67-0

Purity: >95%

Molecular weight: 223.069

Ref: FT-B13573

3-Bromoquinolin-8-amine

CAS: 139399-67-0

Formula: C₉H₇BrN₂

Purity: 98%

Molecular weight: 223.073

Ref: 10-F229554

3-bromoquinolin-8-amine

CAS: 139399-67-0

3-bromoquinolin-8-amine is a chemical compound that belongs to the group of quinolines. It has overlapping functionalities with other compounds and has been shown to have autofluorescent properties. 3-Bromoquinolin-8-amine can be used in assays, such as mass spectrometric analysis and kinetic studies, to determine its concentration response curves. This compound also has potential for use in cheminformatics and transfection experiments, although validation studies are required.

Formula: C₉H₇BrN₂

Purity: Min. 95%

Molecular weight: 223.1 g/mol

Ref: 3D-PFA39967