CAS 1394003-65-6

Ethyl 2-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate

Description:

Ethyl 2-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate is a chemical compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both a pyrazole and a pyrimidine ring. This compound features a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of a chlorine atom at the 2-position of the pyrazolo ring enhances its electrophilic properties, making it a useful intermediate in various chemical reactions. Ethyl 2-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate is often studied for its biological activities, including potential pharmaceutical applications, due to the presence of heterocyclic rings that can interact with biological targets. Its solubility and stability in organic solvents make it suitable for various laboratory applications. As with many chemical substances, safety precautions should be observed when handling this compound, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.

Formula: C₉H₈ClN₃O₂

InChI: InChI=1S/C9H8ClN3O2/c1-2-15-9(14)6-7(10)12-13-5-3-4-11-8(6)13/h3-5H,2H2,1H3

InChI key: InChIKey=WYDKSIFRIJGMBA-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C2N(N=C1Cl)C=CC=N2

Synonyms:

• Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 2-chloro-, ethyl ester
• Ethyl 2-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate

Ethyl 2-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate

CAS: 1394003-65-6

Formula: C₉H₈ClN₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 225.6317

Ref: IN-DA001AYF

Ethyl 2-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate

CAS: 1394003-65-6

Ethyl 2-chloropyrazolo[1,5-a]pyrimidine-3-carboxylate

Purity: 95%

Molecular weight: 225.63g/mol

Ref: 54-OR86965

ETHYL 2-CHLOROPYRAZOLO[1,5-A]PYRIMIDINE-3-CARBOXYLATE

CAS: 1394003-65-6

Purity: 95.0%

Molecular weight: 225.6300048828125

Ref: 10-F305726