CymitQuimica logo

CAS 1394040-05-1

:

2,5-Difluoro-4-methylbenzenesulfonyl chloride

Description:
2,5-Difluoro-4-methylbenzenesulfonyl chloride is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring that is further substituted with two fluorine atoms and a methyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, especially for the introduction of sulfonyl groups into various substrates. The presence of fluorine atoms enhances its electrophilic character and can influence its solubility and stability. As with many sulfonyl chlorides, it is likely to be sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Proper safety measures should be taken when working with this compound due to its potential irritant properties and reactivity with nucleophiles.
Formula:C7H5ClF2O2S
InChI:InChI=1S/C7H5ClF2O2S/c1-4-2-6(10)7(3-5(4)9)13(8,11)12/h2-3H,1H3
InChI key:InChIKey=CAIAONLMJMHUKR-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(F)C=C(C)C(F)=C1
Synonyms:
  • Benzenesulfonyl chloride, 2,5-difluoro-4-methyl-
  • 2,5-Difluoro-4-methylbenzenesulfonyl chloride
Found 1 products.