CAS 1394040-16-4

Benzenamine, 2-(3,5-difluorophenoxy)-, hydrochloride (1:1)

Description:

Benzenamine, 2-(3,5-difluorophenoxy)-, hydrochloride (1:1), also known by its CAS number 1394040-16-4, is a chemical compound characterized by its amine functional group and a difluorophenoxy substituent. This substance typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its ionic nature due to the presence of the hydrochloride moiety. The difluorophenoxy group contributes to its unique electronic properties, potentially influencing its reactivity and interaction with biological systems. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may exhibit various biological activities, making it of interest in pharmaceutical research and development. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices. Overall, its structural features suggest potential applications in medicinal chemistry and related fields.

Formula: C₁₂H₉F₂NO·ClH

InChI: InChI=1S/C12H9F2NO.ClH/c13-8-5-9(14)7-10(6-8)16-12-4-2-1-3-11(12)15;/h1-7H,15H2;1H

InChI key: InChIKey=ZHAACLIIKBYKPZ-UHFFFAOYSA-N

SMILES: O(C1=CC(F)=CC(F)=C1)C2=C(N)C=CC=C2.Cl

Synonyms:

• Benzenamine, 2-(3,5-difluorophenoxy)-, hydrochloride (1:1)

2-(3,5-Difluorophenoxy)aniline hydrochloride

CAS: 1394040-16-4

Versatile small molecule scaffold

Formula: C₁₂H₁₀ClF₂NO

Purity: Min. 95%

Molecular weight: 257.66 g/mol

Ref: 3D-UFC04016