CAS 1394040-28-8

Benzenecarboximidamide, N-(2-methoxyethyl)-4-methyl-, hydrochloride (1:1)

Description:

Benzenecarboximidamide, N-(2-methoxyethyl)-4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a benzenecarboximidamide moiety and a methoxyethyl group. The presence of the hydrochloride indicates that it is a salt form, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. This compound typically exhibits properties associated with amides, such as moderate polarity and potential hydrogen bonding capabilities, which can influence its reactivity and interaction with biological systems. The methoxyethyl substituent may contribute to its lipophilicity, affecting its pharmacokinetic profile. Additionally, the 4-methyl group on the benzene ring can influence the compound's electronic properties and steric hindrance, potentially impacting its biological activity. Overall, this compound's characteristics make it of interest in medicinal chemistry, where it may serve as a lead compound for further development in therapeutic applications.

Formula: C₁₁H₁₆N₂O·ClH

InChI: InChI=1S/C11H16N2O.ClH/c1-9-3-5-10(6-4-9)11(12)13-7-8-14-2;/h3-6H,7-8H2,1-2H3,(H2,12,13);1H

InChI key: InChIKey=OTZZFCBPOTVBPI-UHFFFAOYSA-N

SMILES: C(NCCOC)(=N)C1=CC=C(C)C=C1.Cl

Synonyms:

• Benzenecarboximidamide, N-(2-methoxyethyl)-4-methyl-, hydrochloride (1:1)

N-(2-Methoxyethyl)-4-methylbenzene-1-carboximidamide hydrochloride

CAS: 1394040-28-8

Versatile small molecule scaffold

Formula: C₁₁H₁₇ClN₂O

Purity: Min. 95%

Molecular weight: 228.72 g/mol

Ref: 3D-UFC04028