CAS 1394040-40-4

1-(2-Ethoxyethyl)cyclobutanemethanamine

Description:

1-(2-Ethoxyethyl)cyclobutanemethanamine is an organic compound characterized by its unique structure, which includes a cyclobutane ring and an ethoxyethyl side chain. This compound features a primary amine functional group, which contributes to its reactivity and potential for forming hydrogen bonds. The presence of the ethoxy group enhances its solubility in organic solvents and may influence its biological activity. The cyclobutane ring provides a degree of rigidity to the molecule, which can affect its conformational properties and interactions with other substances. As a relatively complex amine, it may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its CAS number, 1394040-40-4, allows for precise identification in chemical databases. Overall, the characteristics of this compound suggest potential applications in various fields, including pharmaceuticals and materials science, although specific data on its biological activity and physical properties would require further investigation.

Formula: C₉H₁₉NO

InChI: InChI=1S/C9H19NO/c1-2-11-7-6-9(8-10)4-3-5-9/h2-8,10H2,1H3

InChI key: InChIKey=AUXMJHJWQFKJDJ-UHFFFAOYSA-N

SMILES: C(COCC)C1(CN)CCC1

Synonyms:

• Cyclobutanemethanamine, 1-(2-ethoxyethyl)-
• 1-(2-Ethoxyethyl)cyclobutanemethanamine

[1-(2-Ethoxyethyl)cyclobutyl]methanamine

CAS: 1394040-40-4

Versatile small molecule scaffold

Formula: C₉H₁₉NO

Purity: Min. 95%

Molecular weight: 157.25 g/mol

Ref: 3D-UFC04040