CAS 1394040-42-6

Morpholine, 4-[2-(3-pyrrolidinyloxy)ethyl]-, hydrochloride (1:2)

Description:

Morpholine, 4-[2-(3-pyrrolidinyloxy)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its morpholine and pyrrolidine functional groups, which contribute to its unique properties. It typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydrochloride indicates that it is a salt form, which often enhances its stability and solubility. This compound may exhibit biological activity, potentially serving as a pharmacological agent or a building block in medicinal chemistry. Its structure suggests it could interact with biological systems, possibly influencing neurotransmitter pathways or other physiological processes. As with many morpholine derivatives, it may also possess properties such as basicity and the ability to form hydrogen bonds, which can be crucial for its reactivity and interaction with other molecules. Safety data and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₀H₂₀N₂O₂·2ClH

InChI: InChI=1S/C10H20N2O2.2ClH/c1-2-11-9-10(1)14-8-5-12-3-6-13-7-4-12;;/h10-11H,1-9H2;2*1H

InChI key: InChIKey=TWWQGGILSZTOPP-UHFFFAOYSA-N

SMILES: O(CCN1CCOCC1)C2CCNC2.Cl

Synonyms:

• Morpholine, 4-[2-(3-pyrrolidinyloxy)ethyl]-, hydrochloride (1:2)

4-[2-(Pyrrolidin-3-yloxy)ethyl]morpholine dihydrochloride

CAS: 1394040-42-6

Versatile small molecule scaffold

Formula: C₁₀H₂₂Cl₂N₂O₂

Purity: Min. 95%

Molecular weight: 273.2 g/mol

Ref: 3D-UFC04042