CAS 1394040-73-3

Imidazo[2,1-b]thiazole-3-propanoic acid, 6-methyl-, hydrobromide (1:1)

Description:

Imidazo[2,1-b]thiazole-3-propanoic acid, 6-methyl-, hydrobromide (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and thiazole rings. This compound features a propanoic acid moiety and a methyl group at the 6-position of the imidazole ring, contributing to its biological activity and potential pharmacological properties. The hydrobromide salt form indicates that it is combined with hydrobromic acid, enhancing its solubility in polar solvents, which is often advantageous for drug formulation and delivery. The presence of both acidic and basic functional groups suggests that it may exhibit zwitterionic behavior under certain conditions. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of antimicrobial and anticancer research. Its specific interactions and mechanisms of action would require further investigation through experimental studies to elucidate its therapeutic potential and safety profile.

Formula: C₉H₁₀N₂O₂S·BrH

InChI: InChI=1S/C9H10N2O2S.BrH/c1-6-4-11-7(2-3-8(12)13)5-14-9(11)10-6;/h4-5H,2-3H2,1H3,(H,12,13);1H

InChI key: InChIKey=RLRFITOVNDMHBC-UHFFFAOYSA-N

SMILES: C(CC(O)=O)C=1N2C(SC1)=NC(C)=C2.Br

Synonyms:

• Imidazo[2,1-b]thiazole-3-propanoic acid, 6-methyl-, hydrobromide (1:1)

3-{6-Methylimidazo[2,1-b][1,3]thiazol-3-yl}propanoic acid hydrobromide

CAS: 1394040-73-3

Versatile small molecule scaffold

Formula: C₉H₁₁BrN₂O₂S

Purity: Min. 95%

Molecular weight: 291.17 g/mol

Ref: 3D-UFC04073