CAS 1394040-75-5

Cyclobutanamine, 2-methyl-3-phenyl-, hydrochloride (1:1)

Description:

Cyclobutanamine, 2-methyl-3-phenyl-, hydrochloride (1:1) is a chemical compound characterized by its cyclic structure and the presence of both amine and phenyl functional groups. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The compound features a cyclobutane ring, which contributes to its unique steric and electronic properties, influencing its reactivity and interaction with biological systems. The presence of the methyl and phenyl substituents on the cyclobutane ring can affect its lipophilicity and overall pharmacokinetic profile. In terms of safety and handling, like many amines, it may pose risks such as irritation to the skin and eyes, and appropriate safety measures should be taken when working with it. Its specific applications and biological activity would depend on further research and characterization, particularly in the context of medicinal chemistry.

Formula: C₁₁H₁₅N·ClH

InChI: InChI=1S/C11H15N.ClH/c1-8-10(7-11(8)12)9-5-3-2-4-6-9;/h2-6,8,10-11H,7,12H2,1H3;1H

InChI key: InChIKey=JXZMESIPVOJFIY-UHFFFAOYSA-N

SMILES: CC1C(CC1N)C2=CC=CC=C2.Cl

Synonyms:

• Cyclobutanamine, 2-methyl-3-phenyl-, hydrochloride (1:1)

2-Methyl-3-phenylcyclobutan-1-amine hydrochloride

CAS: 1394040-75-5

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClN

Purity: Min. 95%

Molecular weight: 197.7 g/mol

Ref: 3D-UFC04075