CAS 1394040-78-8

2-Oxazolidinone, 3-[2-(methylamino)ethyl]-, hydrochloride (1:1)

Description:

2-Oxazolidinone, 3-[2-(methylamino)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its oxazolidinone core structure, which features a five-membered ring containing both nitrogen and oxygen atoms. This compound is typically a white to off-white crystalline solid, soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The methylaminoethyl side chain contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the hydrochloride indicates that it is a salt, which can influence its pharmacokinetic properties, such as absorption and distribution in biological systems. As with many oxazolidinones, this compound may exhibit antibacterial or other therapeutic properties, although specific biological activities would need to be confirmed through empirical studies. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₆H₁₂N₂O₂.ClH

InChI: InChI=1S/C6H12N2O2.ClH/c1-7-2-3-8-4-5-10-6(8)9;/h7H,2-5H2,1H3;1H

InChI key: InChIKey=WFHNFLOIOYXRKA-UHFFFAOYSA-N

SMILES: C(CNC)N1C(=O)OCC1.Cl

3-[2-(Methylamino)ethyl]-1,3-oxazolidin-2-one hydrochloride

CAS: 1394040-78-8

Versatile small molecule scaffold

Formula: C₆H₁₃ClN₂O₂

Purity: Min. 95%

Molecular weight: 180.63 g/mol

Ref: 3D-UFC04078