CAS 1394041-05-4

5-Methyl-4-[(methylthio)methyl]-2-thiophenecarboxylic acid

Description:

5-Methyl-4-[(methylthio)methyl]-2-thiophenecarboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic ring containing sulfur. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a methylthio group indicates that a methyl group is attached to a sulfur atom, which can influence the compound's reactivity and solubility. The methyl substituent on the thiophene ring enhances its lipophilicity, potentially affecting its biological activity and interaction with other molecules. This compound may exhibit interesting properties such as antimicrobial or antifungal activity, typical of thiophene derivatives. Its synthesis and applications could be relevant in pharmaceuticals, agrochemicals, or materials science. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would depend on the molecular interactions and the environment in which the compound is studied. Safety and handling precautions should be observed due to the potential reactivity of the functional groups present.

Formula: C₈H₁₀O₂S₂

InChI: InChI=1S/C8H10O2S2/c1-5-6(4-11-2)3-7(12-5)8(9)10/h3H,4H2,1-2H3,(H,9,10)

InChI key: InChIKey=QIJGPJZVZPAKLS-UHFFFAOYSA-N

SMILES: C(SC)C=1C=C(C(O)=O)SC1C

Synonyms:

• 2-Thiophenecarboxylic acid, 5-methyl-4-[(methylthio)methyl]-
• 5-Methyl-4-[(methylthio)methyl]-2-thiophenecarboxylic acid

5-Methyl-4-[(methylsulfanyl)methyl]thiophene-2-carboxylic acid

CAS: 1394041-05-4

Versatile small molecule scaffold

Formula: C₈H₁₀O₂S₂

Purity: Min. 95%

Molecular weight: 202.3 g/mol

Ref: 3D-UFC04105