CAS 1394041-11-2

1H-Imidazole, 5-(chloromethyl)-2-(4-chlorophenyl)-, hydrochloride (1:1)

Description:

1H-Imidazole, 5-(chloromethyl)-2-(4-chlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a chloromethyl group at the 5-position and a 4-chlorophenyl group at the 2-position contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its utility in various applications, including pharmaceuticals and research. The compound may exhibit properties such as antimicrobial or antifungal activity, owing to the imidazole moiety, which is commonly found in many biologically active compounds. Its synthesis and characterization would involve standard organic chemistry techniques, and it is essential to handle it with care due to the presence of chlorine substituents, which can impart toxicity. Overall, this compound's structural features suggest potential for diverse applications in medicinal chemistry and material science.

Formula: C₁₀H₈Cl₂N₂·ClH

InChI: InChI=1S/C10H8Cl2N2.ClH/c11-5-9-6-13-10(14-9)7-1-3-8(12)4-2-7;/h1-4,6H,5H2,(H,13,14);1H

InChI key: InChIKey=FUBVGGWAJZPHSV-UHFFFAOYSA-N

SMILES: C(Cl)C=1NC(=NC1)C2=CC=C(Cl)C=C2.Cl

Synonyms:

• 1H-Imidazole, 5-(chloromethyl)-2-(4-chlorophenyl)-, hydrochloride (1:1)

4-(Chloromethyl)-2-(4-chlorophenyl)-1H-imidazole hydrochloride

CAS: 1394041-11-2

Versatile small molecule scaffold

Formula: C₁₀H₉Cl₃N₂

Purity: Min. 95%

Molecular weight: 263.5 g/mol

Ref: 3D-UFC04111