CAS 1394041-14-5

4-(1-Hydroxyethyl)-1H-1,2,3-triazole-1-acetic acid

Description:

4-(1-Hydroxyethyl)-1H-1,2,3-triazole-1-acetic acid is a chemical compound characterized by its unique triazole ring structure, which contributes to its biological activity. This compound features a hydroxyl group and an acetic acid moiety, enhancing its solubility and reactivity. It is typically a white to off-white solid, and its molecular structure allows for potential interactions with various biological targets, making it of interest in pharmaceutical research. The presence of the triazole ring is significant in medicinal chemistry, as it can exhibit antifungal, antibacterial, and anticancer properties. Additionally, the hydroxyl and carboxylic acid functional groups may facilitate hydrogen bonding, influencing its pharmacokinetics and bioavailability. The compound's CAS number, 1394041-14-5, is a unique identifier that aids in its classification and retrieval in chemical databases. Overall, this substance represents a class of compounds that may have diverse applications in drug development and agricultural chemistry.

Formula: C₆H₉N₃O₃

InChI: InChI=1S/C6H9N3O3/c1-4(10)5-2-9(8-7-5)3-6(11)12/h2,4,10H,3H2,1H3,(H,11,12)

InChI key: InChIKey=NEFLDPKMRIMEJL-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C=C(C(C)O)N=N1

Synonyms:

• 1H-1,2,3-Triazole-1-acetic acid, 4-(1-hydroxyethyl)-
• 4-(1-Hydroxyethyl)-1H-1,2,3-triazole-1-acetic acid

2-[4-(1-Hydroxyethyl)-1H-1,2,3-triazol-1-yl]acetic acid

CAS: 1394041-14-5

Versatile small molecule scaffold

Formula: C₆H₉N₃O₃

Purity: Min. 95%

Molecular weight: 171.15 g/mol

Ref: 3D-UFC04114