CAS 1394041-25-8

1-Bromo-2-(2-isocyanatopropyl)benzene

Description:

1-Bromo-2-(2-isocyanatopropyl)benzene, with the CAS number 1394041-25-8, is an organic compound characterized by the presence of both bromine and isocyanate functional groups attached to a benzene ring. This compound features a bromine atom at the 1-position and an isocyanatopropyl group at the 2-position of the benzene ring, which contributes to its reactivity and potential applications in organic synthesis. The isocyanate group is known for its ability to participate in various chemical reactions, including nucleophilic addition and polymerization, making this compound of interest in the development of specialty chemicals and materials. Additionally, the presence of the bromine atom can facilitate further substitution reactions, enhancing its utility in synthetic chemistry. As with many isocyanates, it is important to handle this compound with care due to its potential toxicity and reactivity. Overall, 1-Bromo-2-(2-isocyanatopropyl)benzene is a versatile intermediate in organic synthesis, particularly in the fields of pharmaceuticals and materials science.

Formula: C₁₀H₁₀BrNO

InChI: InChI=1S/C10H10BrNO/c1-8(12-7-13)6-9-4-2-3-5-10(9)11/h2-5,8H,6H2,1H3

InChI key: InChIKey=UBSKKEZRIWMXBO-UHFFFAOYSA-N

SMILES: C(C(N=C=O)C)C1=C(Br)C=CC=C1

Synonyms:

• 1-Bromo-2-(2-isocyanatopropyl)benzene
• Benzene, 1-bromo-2-(2-isocyanatopropyl)-

1-Bromo-2-(2-isocyanatopropyl)benzene

CAS: 1394041-25-8

Versatile small molecule scaffold

Formula: C₁₀H₁₀BrNO

Purity: Min. 95%

Molecular weight: 240.1 g/mol

Ref: 3D-UFC04125