CAS 1394041-28-1

3-Methoxy-2-thiophenesulfonamide

Description:

3-Methoxy-2-thiophenesulfonamide is a chemical compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a methoxy group (-OCH3) and a sulfonamide group (-SO2NH2) attached to the thiophene structure, contributing to its unique chemical properties. The methoxy group enhances the compound's solubility and reactivity, while the sulfonamide moiety can participate in various chemical reactions, including nucleophilic substitutions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of both electron-donating (methoxy) and electron-withdrawing (sulfonamide) groups can influence its electronic properties, reactivity, and interaction with biological targets. As with many sulfonamides, it may also possess antibacterial properties, although specific biological activities would require further investigation. Overall, 3-Methoxy-2-thiophenesulfonamide represents a versatile scaffold for further chemical exploration and potential applications in drug development.

Formula: C₅H₇NO₃S₂

InChI: InChI=1S/C5H7NO3S2/c1-9-4-2-3-10-5(4)11(6,7)8/h2-3H,1H3,(H2,6,7,8)

InChI key: InChIKey=DGRQYAZHUZLDRU-UHFFFAOYSA-N

SMILES: S(N)(=O)(=O)C1=C(OC)C=CS1

Synonyms:

• 3-Methoxy-2-thiophenesulfonamide
• 2-Thiophenesulfonamide, 3-methoxy-

3-Methoxythiophene-2-sulfonamide

CAS: 1394041-28-1

Versatile small molecule scaffold

Formula: C₅H₇NO₃S₂

Purity: Min. 95%

Molecular weight: 193.2 g/mol

Ref: 3D-UFC04128