CAS 1394041-46-3

3-Pyridinecarboxamide, N-(2-hydroxypropyl)-, hydrochloride (1:1)

Description:

3-Pyridinecarboxamide, N-(2-hydroxypropyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which contributes to its aromatic properties and potential biological activity. The presence of the carboxamide functional group indicates that it can participate in hydrogen bonding, enhancing its solubility in polar solvents. The N-(2-hydroxypropyl) substituent introduces a hydroxyl group, which can further increase hydrophilicity and may influence the compound's interaction with biological systems. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific applications and effects would depend on its interaction with biological targets, which could be explored through further research. Overall, the combination of its structural features suggests potential utility in various chemical and pharmaceutical contexts.

Formula: C₉H₁₂N₂O₂·ClH

InChI: InChI=1S/C9H12N2O2.ClH/c1-7(12)5-11-9(13)8-3-2-4-10-6-8;/h2-4,6-7,12H,5H2,1H3,(H,11,13);1H

InChI key: InChIKey=SFIFCSGSHPDRCQ-UHFFFAOYSA-N

SMILES: C(NCC(C)O)(=O)C=1C=CC=NC1.Cl

Synonyms:

• 3-Pyridinecarboxamide, N-(2-hydroxypropyl)-, hydrochloride (1:1)

N-(2-Hydroxypropyl)pyridine-3-carboxamide hydrochloride

CAS: 1394041-46-3

Versatile small molecule scaffold

Formula: C₉H₁₃ClN₂O₂

Purity: Min. 95%

Molecular weight: 216.66 g/mol

Ref: 3D-UFC04146