CAS 1394041-50-9

Phenol, 3-(2-amino-2-phenylethyl)-, hydrobromide (1:1)

Description:

Phenol, 3-(2-amino-2-phenylethyl)-, hydrobromide (1:1) is a chemical compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of the amino group (-NH2) linked to a phenylethyl chain contributes to its potential biological activity, making it of interest in medicinal chemistry. The hydrobromide form indicates that the compound is a salt formed with hydrobromic acid, which can enhance its solubility in water and influence its pharmacokinetic properties. This compound may exhibit properties such as being a weak base due to the amino group and can participate in hydrogen bonding due to both the hydroxyl and amino functionalities. Its molecular interactions may be relevant in various applications, including pharmaceuticals and organic synthesis. As with many phenolic compounds, it may also display antioxidant properties. However, specific biological activities and applications would require further investigation through empirical studies.

Formula: C₁₄H₁₅NO·BrH

InChI: InChI=1S/C14H15NO.BrH/c15-14(12-6-2-1-3-7-12)10-11-5-4-8-13(16)9-11;/h1-9,14,16H,10,15H2;1H

InChI key: InChIKey=HAAUGZFVQSCZOM-UHFFFAOYSA-N

SMILES: C(CC1=CC(O)=CC=C1)(N)C2=CC=CC=C2.Br

Synonyms:

• Phenol, 3-(2-amino-2-phenylethyl)-, hydrobromide (1:1)

3-(2-Amino-2-phenylethyl)phenol hydrobromide

CAS: 1394041-50-9

Versatile small molecule scaffold

Formula: C₁₄H₁₆BrNO

Purity: Min. 95%

Molecular weight: 294.19 g/mol

Ref: 3D-UFC04150