CAS 1394041-52-1

Methyl 6-chloro-3-oxo-1,2,4-triazolo[4,3-b]pyridazine-2(3H)-acetate

Description:

Methyl 6-chloro-3-oxo-1,2,4-triazolo[4,3-b]pyridazine-2(3H)-acetate is a heterocyclic compound characterized by its complex structure, which includes a triazole ring fused to a pyridazine moiety. This compound features a chloro substituent and an ester functional group, contributing to its reactivity and potential biological activity. The presence of the triazole ring suggests possible applications in medicinal chemistry, as triazoles are known for their antifungal and antimicrobial properties. The methyl ester group may enhance lipophilicity, influencing the compound's solubility and permeability in biological systems. Additionally, the chlorine atom can affect the electronic properties and reactivity of the molecule, potentially impacting its interaction with biological targets. Overall, this compound's unique structural features may make it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. However, specific data regarding its physical properties, biological activity, and safety profile would require further investigation and characterization.

Formula: C₈H₇ClN₄O₃

InChI: InChI=1S/C8H7ClN4O3/c1-16-7(14)4-12-8(15)13-6(11-12)3-2-5(9)10-13/h2-3H,4H2,1H3

InChI key: InChIKey=UDMIMFLYNLCVAL-UHFFFAOYSA-N

SMILES: O=C1N2C(=NN1CC(OC)=O)C=CC(Cl)=N2

Synonyms:

• 1,2,4-Triazolo[4,3-b]pyridazine-2(3H)-acetic acid, 6-chloro-3-oxo-, methyl ester
• Methyl 6-chloro-3-oxo-1,2,4-triazolo[4,3-b]pyridazine-2(3H)-acetate

Methyl 2-{6-chloro-3-oxo-2H,3H-[1,2,4]triazolo[4,3-b]pyridazin-2-yl}acetate

CAS: 1394041-52-1

Versatile small molecule scaffold

Formula: C₈H₇ClN₄O₃

Purity: Min. 95%

Molecular weight: 242.62 g/mol

Ref: 3D-UFC04152