CAS 1394041-59-8

1H-1,2,3-Triazole-1-acetic acid, 4-(aminomethyl)-, hydrochloride (1:1)

Description:

1H-1,2,3-Triazole-1-acetic acid, 4-(aminomethyl)-, hydrochloride (1:1) is a chemical compound characterized by its triazole ring structure, which is a five-membered aromatic ring containing three nitrogen atoms. This compound features an acetic acid moiety and an aminomethyl group, contributing to its potential as a versatile building block in medicinal chemistry. The hydrochloride salt form indicates that it is a protonated species, enhancing its solubility in aqueous environments, which is beneficial for biological applications. The presence of the triazole ring suggests potential antimicrobial and antifungal properties, while the aminomethyl group may facilitate interactions with biological targets. This compound is of interest in pharmaceutical research, particularly for its potential roles in drug development and synthesis. Its unique structural features may also allow for various modifications, leading to derivatives with enhanced activity or selectivity. As with many triazole derivatives, it may exhibit interesting pharmacological properties, making it a subject of study in the field of medicinal chemistry.

Formula: C₅H₈N₄O₂·ClH

InChI: InChI=1S/C5H8N4O2.ClH/c6-1-4-2-9(8-7-4)3-5(10)11;/h2H,1,3,6H2,(H,10,11);1H

InChI key: InChIKey=HULZHVFPZYNWOT-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C=C(CN)N=N1.Cl

Synonyms:

• 1H-1,2,3-Triazole-1-acetic acid, 4-(aminomethyl)-, hydrochloride (1:1)

2-[4-(Aminomethyl)-1H-1,2,3-triazol-1-yl]acetic acid hydrochloride

CAS: 1394041-59-8

Versatile small molecule scaffold

Formula: C₅H₉ClN₄O₂

Purity: Min. 95%

Molecular weight: 192.6 g/mol

Ref: 3D-UFC04159