CAS 1394041-63-4

1H-Pyrazole-4-methanamine, N-methyl-1-(2-propyn-1-yl)-, hydrochloride (1:1)

Description:

1H-Pyrazole-4-methanamine, N-methyl-1-(2-propyn-1-yl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two nitrogen atoms. This compound features a methanamine group and a propynyl substituent, contributing to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of the N-methyl group suggests that it may exhibit specific pharmacological properties, potentially influencing its interaction with biological targets. The compound's CAS number, 1394041-63-4, allows for precise identification in chemical databases. Its characteristics, including melting point, solubility, and stability, would depend on the specific conditions under which it is handled. Overall, this compound may be of interest in medicinal chemistry and research due to its structural features and potential applications.

Formula: C₈H₁₁N₃·ClH

InChI: InChI=1S/C8H11N3.ClH/c1-3-4-11-7-8(5-9-2)6-10-11;/h1,6-7,9H,4-5H2,2H3;1H

InChI key: InChIKey=PRPXRHHJUIPHGH-UHFFFAOYSA-N

SMILES: C(NC)C1=CN(CC#C)N=C1.Cl

Synonyms:

• 1H-Pyrazole-4-methanamine, N-methyl-1-(2-propyn-1-yl)-, hydrochloride (1:1)

Methyl({[1-(prop-2-yn-1-yl)-1H-pyrazol-4-yl]methyl})amine hydrochloride

CAS: 1394041-63-4

Versatile small molecule scaffold

Formula: C₈H₁₂ClN₃

Purity: Min. 95%

Molecular weight: 185.65 g/mol

Ref: 3D-UFC04163