CAS 1394041-66-7

Ethyl 1-(2-cyanoethyl)-1H-pyrazole-4-carboxylate

Description:

Ethyl 1-(2-cyanoethyl)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a carboxylate group and a cyanoethyl substituent, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the ethyl ester group enhances its solubility in organic solvents, making it suitable for various chemical reactions. The cyano group introduces a polar character, which can influence the compound's interactions with biological targets. Ethyl 1-(2-cyanoethyl)-1H-pyrazole-4-carboxylate may exhibit interesting biological activities, making it a candidate for further research in drug development. Its unique structural features allow for potential modifications, which can lead to derivatives with enhanced properties. As with many pyrazole derivatives, it may also serve as a building block in the synthesis of more complex molecules. Proper handling and safety measures should be observed due to its chemical nature.

Formula: C₉H₁₁N₃O₂

InChI: InChI=1S/C9H11N3O2/c1-2-14-9(13)8-6-11-12(7-8)5-3-4-10/h6-7H,2-3,5H2,1H3

InChI key: InChIKey=IQBKPLDDGGVCFI-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CN(CCC#N)N=C1

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 1-(2-cyanoethyl)-, ethyl ester
• Ethyl 1-(2-cyanoethyl)-1H-pyrazole-4-carboxylate

Ethyl 1-(2-cyanoethyl)-1H-pyrazole-4-carboxylate

CAS: 1394041-66-7

Versatile small molecule scaffold

Formula: C₉H₁₁N₃O₂

Purity: Min. 95%

Molecular weight: 193.2 g/mol

Ref: 3D-UFC04166