CAS 1394041-94-1

1,1-Dimethylethyl 4-(hydroxymethyl)-1H-1,2,3-triazole-1-acetate

Description:

1,1-Dimethylethyl 4-(hydroxymethyl)-1H-1,2,3-triazole-1-acetate, with the CAS number 1394041-94-1, is a chemical compound that features a triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound is characterized by the presence of a hydroxymethyl group and an acetate moiety, contributing to its potential reactivity and solubility properties. The dimethyl group attached to the ethyl group suggests steric hindrance, which may influence its interactions with other molecules. The triazole structure is known for its biological activity, often serving as a scaffold in pharmaceuticals and agrochemicals. The compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in various applications. Its synthesis typically involves the reaction of appropriate precursors under controlled conditions, and its stability can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a unique combination of functional groups that may lend itself to diverse chemical behavior and potential applications in medicinal chemistry.

Formula: C₉H₁₅N₃O₃

InChI: InChI=1S/C9H15N3O3/c1-9(2,3)15-8(14)5-12-4-7(6-13)10-11-12/h4,13H,5-6H2,1-3H3

InChI key: InChIKey=ZIKQEFBJVMVLHP-UHFFFAOYSA-N

SMILES: C(C(OC(C)(C)C)=O)N1C=C(CO)N=N1

Synonyms:

• 1H-1,2,3-Triazole-1-acetic acid, 4-(hydroxymethyl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 4-(hydroxymethyl)-1H-1,2,3-triazole-1-acetate

Tert-butyl 2-[4-(hydroxymethyl)-1H-1,2,3-triazol-1-yl]acetate

CAS: 1394041-94-1

Purity: 95%

Molecular weight: 213.2369995

Ref: 10-F718253

tert-Butyl 2-[4-(hydroxymethyl)-1H-1,2,3-triazol-1-yl]acetate

CAS: 1394041-94-1

Versatile small molecule scaffold

Formula: C₉H₁₅N₃O₃

Purity: Min. 95%

Molecular weight: 213.23 g/mol

Ref: 3D-UFC04194