CAS 1394042-09-1

2-[(Tetrahydro-2H-pyran-4-yl)sulfonyl]propanoic acid

Description:

2-[(Tetrahydro-2H-pyran-4-yl)sulfonyl]propanoic acid is a chemical compound characterized by its unique structure, which includes a propanoic acid moiety and a tetrahydro-2H-pyran ring linked through a sulfonyl group. This compound typically exhibits properties associated with both acidic and sulfonyl functionalities, making it potentially useful in various chemical applications, including pharmaceuticals and organic synthesis. The presence of the tetrahydro-2H-pyran ring contributes to its cyclic nature, which can influence its reactivity and interaction with biological systems. Additionally, the sulfonyl group enhances its polarity, potentially affecting solubility in different solvents. The compound's molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which are critical for its behavior in biological and chemical environments. Overall, 2-[(Tetrahydro-2H-pyran-4-yl)sulfonyl]propanoic acid represents a versatile compound with potential applications in medicinal chemistry and material science.

Formula: C₈H₁₄O₅S

InChI: InChI=1S/C8H14O5S/c1-6(8(9)10)14(11,12)7-2-4-13-5-3-7/h6-7H,2-5H2,1H3,(H,9,10)

InChI key: InChIKey=IZQIJVLDVMGBHY-UHFFFAOYSA-N

SMILES: S(C(C(O)=O)C)(=O)(=O)C1CCOCC1

Synonyms:

• 2-(Oxane-4-sulfonyl)propanoic acid
• Propanoic acid, 2-[(tetrahydro-2H-pyran-4-yl)sulfonyl]-
• 2-[(Tetrahydro-2H-pyran-4-yl)sulfonyl]propanoic acid

2-(Oxane-4-sulfonyl)propanoic acid

CAS: 1394042-09-1

Versatile small molecule scaffold

Formula: C₈H₁₄O₅S

Purity: Min. 95%

Molecular weight: 222.26 g/mol

Ref: 3D-UFC04209