CAS 1394042-39-7: 2-Cyclobutyl-5-thiazolecarboxaldehyde
Description:2-Cyclobutyl-5-thiazolecarboxaldehyde is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a cyclobutyl group, a four-membered carbon ring, attached to the thiazole, contributing to its unique properties. The presence of the aldehyde functional group (-CHO) indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. The thiazole moiety often imparts biological activity, making compounds like this of interest in medicinal chemistry and drug development. Additionally, the structural features of 2-Cyclobutyl-5-thiazolecarboxaldehyde may influence its solubility, reactivity, and interaction with biological targets. Its specific applications and behavior in chemical reactions would depend on its reactivity profile, which can be influenced by the steric and electronic effects of the cyclobutyl and thiazole groups. Overall, this compound represents a fascinating intersection of organic chemistry and potential pharmacological applications.
Formula:C8H9NOS
InChI:InChI=1S/C8H9NOS/c10-5-7-4-9-8(11-7)6-2-1-3-6/h4-6H,1-3H2
InChI key:InChIKey=BQZAQQSRZCHPEG-UHFFFAOYSA-N
SMILES:O=CC=1SC(=NC1)C2CCC2
- Synonyms:
- 2-Cyclobutyl-5-thiazolecarboxaldehyde
- 5-Thiazolecarboxaldehyde, 2-cyclobutyl-
- 2-Cyclobutyl-1,3-thiazole-5-carbaldehyde
- 2-Cyclobutylthiazole-5-carbaldehyde

2-cyclobutyl-1,3-thiazole-5-carbaldehyde
Ref: IN-DA019ZZ5
1g | To inquire | ||
5g | To inquire | ||
10g | To inquire | ||
100mg | 200.00 € | ||
250mg | 318.00 € |

Ref: 54-OR78514
1g | 1,295.00 € | ||
5g | 4,061.00 € | ||
10g | 6,767.00 € | ||
100mg | 380.00 € | ||
250mg | 584.00 € |

2-Cyclobutyl-1,3-thiazole-5-carbaldehyde
Ref: 10-F718265
1g | 717.00 € | ||
5g | 1,972.00 € | ||
10g | 3,285.00 € | ||
100mg | 202.00 € | ||
250mg | 306.00 € |

2-Cyclobutyl-1,3-thiazole-5-carbaldehyde
Ref: 3D-UFC04239
50mg | 559.00 € | ||
500mg | 1,540.00 € |