CAS 1394042-51-3

5-Thiazolecarboxylic acid, 2-cyclopropyl-4-phenyl-

Description:

5-Thiazolecarboxylic acid, 2-cyclopropyl-4-phenyl- is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of a cyclopropyl group and a phenyl group enhances its structural complexity and may influence its biological activity and solubility properties. Thiazole derivatives are often studied for their pharmacological potential, including antimicrobial and anti-inflammatory activities. The specific arrangement of substituents in this compound can affect its interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the compound's molecular weight, melting point, and solubility characteristics would be relevant for applications in drug formulation and development. Overall, 5-Thiazolecarboxylic acid, 2-cyclopropyl-4-phenyl- represents a unique structure that may offer various chemical and biological properties worthy of exploration.

Formula: C₁₃H₁₁NO₂S

InChI: InChI=1S/C13H11NO2S/c15-13(16)11-10(8-4-2-1-3-5-8)14-12(17-11)9-6-7-9/h1-5,9H,6-7H2,(H,15,16)

InChI key: InChIKey=LTEWOOZGTYKUIH-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(N=C(S1)C2CC2)C3=CC=CC=C3

Synonyms:

• 2-Cyclopropyl-4-phenyl-1,3-thiazole-5-carboxylic acid
• 5-Thiazolecarboxylic acid, 2-cyclopropyl-4-phenyl-
• 2-Cyclopropyl-4-phenylthiazole-5-carboxylic acid

2-Cyclopropyl-4-phenyl-1,3-thiazole-5-carboxylic acid

CAS: 1394042-51-3

Versatile small molecule scaffold

Formula: C₁₃H₁₁NO₂S

Purity: Min. 95%

Molecular weight: 245.3 g/mol

Ref: 3D-UFC04251