CAS 1394042-57-9

1-Butanamine, N-methoxy-3-methyl-, hydrochloride (1:1)

Description:

1-Butanamine, N-methoxy-3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amine functional group, which is indicative of its basic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the methoxy group contributes to its potential as a ligand in coordination chemistry and may influence its biological activity. The compound's structure suggests it may exhibit moderate to high polarity, affecting its interaction with biological membranes and its overall bioavailability. Additionally, the presence of the butyl chain can impart hydrophobic characteristics, which may play a role in its pharmacokinetics. Safety data and handling precautions should be considered, as with any amine, due to potential irritant properties. Overall, this compound's unique structural features make it of interest in medicinal chemistry and related fields.

Formula: C₆H₁₅NO·ClH

InChI: InChI=1S/C6H15NO.ClH/c1-6(2)4-5-7-8-3;/h6-7H,4-5H2,1-3H3;1H

InChI key: InChIKey=BUNVKHAXWDBEHX-UHFFFAOYSA-N

SMILES: C(CNOC)C(C)C.Cl

Synonyms:

• 1-Butanamine, N-methoxy-3-methyl-, hydrochloride (1:1)

Methoxy(3-methylbutyl)amine hydrochloride

CAS: 1394042-57-9

Versatile small molecule scaffold

Formula: C₆H₁₆ClNO

Purity: Min. 95%

Molecular weight: 153.65 g/mol

Ref: 3D-UFC04257