CAS 1394042-81-9

2,4,5-Imidazolidinetrione, 1-[3-(4-morpholinyl)propyl]-, hydrochloride (1:1)

Description:

2,4,5-Imidazolidinetrione, 1-[3-(4-morpholinyl)propyl]-, hydrochloride (1:1), with CAS number 1394042-81-9, is a chemical compound characterized by its imidazolidinetrione core, which features a five-membered ring containing nitrogen and carbon atoms, along with a morpholine substituent that enhances its solubility and biological activity. This compound is typically encountered as a hydrochloride salt, which improves its stability and facilitates handling in various applications. The presence of the morpholine group suggests potential interactions with biological systems, making it of interest in pharmaceutical research. Its structure may confer specific pharmacological properties, potentially influencing its efficacy and safety profile. As with many compounds containing nitrogen heterocycles, it may exhibit diverse reactivity patterns, including hydrogen bonding and coordination with metal ions. The compound's properties, such as solubility, melting point, and reactivity, would be influenced by its molecular structure and the presence of functional groups, making it a candidate for further investigation in medicinal chemistry and related fields.

Formula: C₁₀H₁₅N₃O₄·ClH

InChI: InChI=1S/C10H15N3O4.ClH/c14-8-9(15)13(10(16)11-8)3-1-2-12-4-6-17-7-5-12;/h1-7H2,(H,11,14,16);1H

InChI key: InChIKey=GIEVQSAPTIBYEH-UHFFFAOYSA-N

SMILES: C(CCN1CCOCC1)N2C(=O)NC(=O)C2=O.Cl

Synonyms:

• 1-[3-(Morpholin-4-yl)propyl]imidazolidine-2,4,5-trione hydrochloride
• 2,4,5-Imidazolidinetrione, 1-[3-(4-morpholinyl)propyl]-, hydrochloride (1:1)

1-[3-(Morpholin-4-yl)propyl]imidazolidine-2,4,5-trione hydrochloride

CAS: 1394042-81-9

Versatile small molecule scaffold

Formula: C₁₀H₁₆ClN₃O₄

Purity: Min. 95%

Molecular weight: 277.7 g/mol

Ref: 3D-UFC04281