CAS 1394042-84-2

Benzenecarboximidamide, 4-(dimethylamino)-3-fluoro-, hydrochloride (1:2)

Description:

Benzenecarboximidamide, 4-(dimethylamino)-3-fluoro-, hydrochloride (1:2) is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with a carboximidamide group and a dimethylamino group, along with a fluorine atom at the 3-position. The hydrochloride form indicates that the compound is a salt, which enhances its solubility in water and may influence its biological activity. This compound is typically used in pharmaceutical research and development due to its potential biological properties. The presence of the dimethylamino group suggests that it may exhibit basic characteristics, while the fluorine atom can enhance lipophilicity and metabolic stability. As with many compounds containing amine and imine functionalities, it may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding interactions. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory settings. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications.

Formula: C₉H₁₂FN₃·2ClH

InChI: InChI=1S/C9H12FN3.2ClH/c1-13(2)8-4-3-6(9(11)12)5-7(8)10;;/h3-5H,1-2H3,(H3,11,12);2*1H

InChI key: InChIKey=LCNVZTQTSQSRMX-UHFFFAOYSA-N

SMILES: C(=N)(N)C1=CC(F)=C(N(C)C)C=C1.Cl

Synonyms:

• Benzenecarboximidamide, 4-(dimethylamino)-3-fluoro-, hydrochloride (1:2)

4-(Dimethylamino)-3-fluorobenzene-1-carboximidamide dihydrochloride

CAS: 1394042-84-2

Versatile small molecule scaffold

Formula: C₉H₁₄Cl₂FN₃

Purity: Min. 95%

Molecular weight: 254.13 g/mol

Ref: 3D-UFC04284