CAS 1394042-88-6

3-Ethyl-1-(methylsulfonyl)-4-piperidinamine

Description:

3-Ethyl-1-(methylsulfonyl)-4-piperidinamine is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of an ethyl group at the third position and a methylsulfonyl group at the first position contributes to its unique properties. This compound is likely to exhibit moderate polarity due to the sulfonyl group, which can engage in hydrogen bonding and dipole-dipole interactions. The piperidine moiety may impart basicity, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with biological activity. Its solubility profile would depend on the balance between hydrophobic and hydrophilic characteristics imparted by the ethyl and sulfonyl groups, respectively. Overall, 3-Ethyl-1-(methylsulfonyl)-4-piperidinamine represents a versatile scaffold for further chemical exploration and potential therapeutic applications.

Formula: C₈H₁₈N₂O₂S

InChI: InChI=1S/C8H18N2O2S/c1-3-7-6-10(13(2,11)12)5-4-8(7)9/h7-8H,3-6,9H2,1-2H3

InChI key: InChIKey=BBRYFECEGOLZTG-UHFFFAOYSA-N

SMILES: S(C)(=O)(=O)N1CC(CC)C(N)CC1

3-Ethyl-1-methanesulfonylpiperidin-4-amine

CAS: 1394042-88-6

Versatile small molecule scaffold

Formula: C₈H₁₈N₂O₂S

Purity: Min. 95%

Molecular weight: 206.31 g/mol

Ref: 3D-UFC04288