CAS 1394291-33-8

Pyrrolidine, 1-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 1-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a bromo substituent and a trifluoromethyl group on the phenyl ring contributes to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The trifluoromethyl group is known to impart lipophilicity and can influence the compound's pharmacokinetic properties. This compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in the design of compounds with specific therapeutic effects. Safety and handling precautions should be observed due to the presence of halogenated groups, which can pose environmental and health risks.

Formula: C₁₂H₁₃BrF₃N·ClH

InChI: InChI=1S/C12H13BrF3N.ClH/c13-11-4-3-10(12(14,15)16)7-9(11)8-17-5-1-2-6-17;/h3-4,7H,1-2,5-6,8H2;1H

InChI key: InChIKey=QIZXKHDSUMVULR-UHFFFAOYSA-N

SMILES: C(C1=CC(C(F)(F)F)=CC=C1Br)N2CCCC2.Cl

Synonyms:

• Pyrrolidine, 1-[[2-bromo-5-(trifluoromethyl)phenyl]methyl]-, hydrochloride (1:1)

1-[[2-Bromo-5-(trifluoromethyl)phenyl]methyl]-pyrrolidine hydrochloride

CAS: 1394291-33-8

Formula: C₁₂H₁₄BrClF₃N

Purity: 95%

Molecular weight: 344.5985

Ref: IN-DA01K9I7

1-[[2-Bromo-5-(trifluoromethyl)phenyl]methyl]-pyrrolidine hydrochloride

CAS: 1394291-33-8

Purity: ≥95%

Molecular weight: 344.6000061

Ref: 10-F632263