CAS 1394319-40-4: Phenylmethyl 2-(3-thietanylidene)acetate
Description:Phenylmethyl 2-(3-thietanylidene)acetate, identified by its CAS number 1394319-40-4, is an organic compound characterized by the presence of both an acetate functional group and a thietanylidene moiety. The thietanylidene structure introduces a five-membered sulfur-containing ring, which can impart unique chemical reactivity and properties to the compound. Typically, compounds of this nature may exhibit moderate to high lipophilicity due to the presence of aromatic and aliphatic groups, influencing their solubility in organic solvents. The acetate group suggests potential for esterification reactions, while the thietane ring may participate in various nucleophilic or electrophilic reactions, depending on the substituents and reaction conditions. Additionally, the compound may display interesting biological activities, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would involve standard organic chemistry techniques, including spectroscopy for structural elucidation. Overall, the unique combination of functional groups in Phenylmethyl 2-(3-thietanylidene)acetate contributes to its potential applications in various chemical and pharmaceutical contexts.
Formula:C12H12O2S
InChI:InChI=1S/C12H12O2S/c13-12(6-11-8-15-9-11)14-7-10-4-2-1-3-5-10/h1-6H,7-9H2
InChI key:InChIKey=YRMJBZIPJOULRP-UHFFFAOYSA-N
SMILES:O=C(OCC=1C=CC=CC1)C=C2CSC2
- Synonyms:
- Acetic acid, 2-(3-thietanylidene)-, phenylmethyl ester
- Phenylmethyl 2-(3-thietanylidene)acetate
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Benzyl 2-(thietan-3-ylidene)acetate REF: 54-OR312069CAS: 1394319-40-4 | - - - | To inquire | Wed 23 Apr 25 |
 | Benzyl 2-(thietan-3-ylidene)acetate REF: 10-F731607CAS: 1394319-40-4 | 98% | - - - | Discontinued product |
 | Benzyl 2-(thietan-3-ylidene)acetate REF: 3D-UFC31940CAS: 1394319-40-4 | Min. 95% | - - - | Discontinued product |
Ref: 54-OR312069
| Undefined size | To inquire |
Ref: 10-F731607
| 1g | Discontinued | Request information |
Benzyl 2-(thietan-3-ylidene)acetate
Ref: 3D-UFC31940
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
