CAS 1394371-75-5
:4-[5-(4-Chlorophenyl)-4-methyl-2-(1-oxopropyl)-3-thienyl]benzenesulfonamide
Description:
4-[5-(4-Chlorophenyl)-4-methyl-2-(1-oxopropyl)-3-thienyl]benzenesulfonamide, with the CAS number 1394371-75-5, is a synthetic organic compound characterized by its complex structure, which includes a thienyl ring, a sulfonamide group, and a chlorophenyl moiety. This compound typically exhibits properties associated with sulfonamides, such as potential antibacterial activity, although specific biological activities may vary based on its structural features. The presence of the thienyl and chlorophenyl groups suggests possible interactions with biological targets, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can be influenced by the functional groups present, particularly the sulfonamide and ketone functionalities. Additionally, the compound's molecular weight, melting point, and spectral characteristics (such as NMR and IR) would provide further insights into its physical and chemical properties. Overall, this compound may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its efficacy and safety profiles.
Formula:C20H18ClNO3S2
InChI:InChI=1S/C20H18ClNO3S2/c1-3-17(23)20-18(13-6-10-16(11-7-13)27(22,24)25)12(2)19(26-20)14-4-8-15(21)9-5-14/h4-11H,3H2,1-2H3,(H2,22,24,25)
InChI key:InChIKey=DYIIYIJHDMIABW-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=C(C(C)=C(S1)C2=CC=C(Cl)C=C2)C3=CC=C(S(N)(=O)=O)C=C3
Synonyms:- 4-[5-(4-Chlorophenyl)-4-methyl-2-(1-oxopropyl)-3-thienyl]benzenesulfonamide
- Benzenesulfonamide, 4-[5-(4-chlorophenyl)-4-methyl-2-(1-oxopropyl)-3-thienyl]-
- nAChR agonist1
- nAChR agonist 1(DUN71755)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Benzenesulfonamide, 4-[5-(4-chlorophenyl)-4-methyl-2-(1-oxopropyl)-3-thienyl]-
CAS:Formula:C20H18ClNO3S2Purity:98%Color and Shape:SolidMolecular weight:419.9448nAChR agonist 1
CAS:nAChR agonist 1 (DUN71755) is a brain-permeable and orally efficacious positive allosteric α7 nicotinic acetylcholine receptor (α7 nAChR)modulator.
Formula:C20H18ClNO3S2Purity:97.59%Color and Shape:SolidMolecular weight:419.944-(5-(4-Chlorophenyl)-4-Methyl-2-Propionylthiophen-3-Yl)Benzenesulfonamide
CAS:4-(5-(4-Chlorophenyl)-4-Methyl-2-Propionylthiophen-3-Yl)BenzenesulfonamidePurity:98%Molecular weight:419.94g/mol4-(5-(4-CHLOROPHENYL)-4-METHYL-2-PROPIONYLTHIOPHEN-3-YL)BENZENESULFONAMIDE
CAS:Purity:98%Molecular weight:419.9400024DUN71755
CAS:DUN71755 is a nicotinic acetylcholine receptor agonist that has been shown to reduce dyskinesias in primates. It also produces antidyskinetic effects in animals and nonhuman primates, with minimal side effects. DUN71755 is not selective for the nicotinic acetylcholine receptor, however, as it also binds to muscarinic acetylcholine receptors, which may be responsible for its observed side effects such as bradycardia and hypotension.
Formula:C20H18ClNO3S2Purity:Min. 95%Molecular weight:419.9 g/mol




