CAS 139452-21-4

6-Methylpyrazolo[1,5-a]pyridine-3-carboxylic acid

Description:

6-Methylpyrazolo[1,5-a]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. This compound features a methyl group at the 6-position of the pyrazolo ring and a carboxylic acid functional group at the 3-position of the pyridine ring, contributing to its acidic properties. It is typically a crystalline solid and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry and pharmacology, as derivatives of pyrazolo-pyridine structures have been investigated for various biological activities, including anti-inflammatory and analgesic effects. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with any chemical substance, and its reactivity may vary depending on the conditions and presence of other reagents.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c1-6-2-3-8-7(9(12)13)4-10-11(8)5-6/h2-5H,1H3,(H,12,13)

InChI key: InChIKey=OGHHZABNTXETHB-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(N=C1)C=C(C)C=C2

Synonyms:

• Pyrazolo[1,5-a]pyridine-3-carboxylic acid, 6-methyl-
• 6-Methylpyrazolo[1,5-a]pyridine-3-carboxylic acid

6-Methylpyrazolo[1,5-a]pyridine-3-carboxylic acid

CAS: 139452-21-4

Formula: C₉H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 176.1720

Ref: IN-DA001B1S

6-Methylpyrazolo[1,5-a]pyridine-3-carboxylic acid

CAS: 139452-21-4

Purity: 98%

Molecular weight: 176.1750030517578

Ref: 10-F688846