CAS 13947-58-5
:2-(1H-Tetraazol-5-yl)benzoic acid
Description:
2-(1H-Tetraazol-5-yl)benzoic acid, with the CAS number 13947-58-5, is an organic compound characterized by the presence of both a benzoic acid moiety and a tetrazole ring. This compound features a carboxylic acid functional group (-COOH) attached to a benzene ring, which is further substituted with a tetrazole group at the ortho position. The tetrazole ring contributes to the compound's unique chemical properties, including its potential for forming coordination complexes and its use in various applications such as pharmaceuticals and agrochemicals. The presence of the carboxylic acid group enhances its solubility in polar solvents and allows for potential interactions in biological systems. Additionally, the compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its stability, reactivity, and ability to participate in hydrogen bonding are also notable characteristics that influence its behavior in chemical reactions and applications.
Formula:C8H6N4O2
InChI:InChI=1/C8H6N4O2/c13-8(14)6-4-2-1-3-5(6)7-9-11-12-10-7/h1-4H,(H,13,14)(H,9,10,11,12)
SMILES:c1ccc(c(c1)c1n[nH]nn1)C(=O)O
Synonyms:- 2-(2H-Tetrazol-5-yl)benzoic acid
- benzoic acid, 2-(1H-tetrazol-5-yl)-
- benzoic acid, 2-(2H-tetrazol-5-yl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(1H-Tetrazol-5-yl)-benzoic acid
CAS:2-(1H-Tetrazol-5-yl)-benzoic acid is a chloride salt of 2-(1H-tetrazol-5-yl)benzoic acid. It is soluble in water and organic solvents. The compound has a carboxylate group, which is the reactive part of the molecule. This group can be modified by reactions with other molecules, such as hydrothermal reactions that result in modifications to the structure of the carboxylate group. Tetrazole groups are found in many compounds, including those used in chemistry and octahedrally coordinated ligands. The coordination geometry of cadmium ions is tetrahedral, making it a good ligand for this type of compound. Crystal structures have been obtained for compounds containing both 2-(1H-tetrazol-5-yl)-benzoic acid and cadmium ions as ligands.Formula:C8H6N4O2Purity:Min. 95%Molecular weight:190.16 g/mol

