CAS 139484-40-5
:4-(2-OXO-2-PHENYLETHOXY)BENZALDEHYDE
Description:
4-(2-Oxo-2-phenylethoxy)benzaldehyde, with the CAS number 139484-40-5, is an organic compound characterized by its aromatic structure and functional groups. It features a benzaldehyde moiety, which is a key component contributing to its reactivity and potential applications in organic synthesis. The presence of the 2-oxo-2-phenylethoxy group indicates that it has both ketone and ether functionalities, which can influence its chemical behavior, including its solubility and reactivity with nucleophiles. This compound may exhibit properties typical of aldehydes, such as being a potential electrophile in various chemical reactions. Additionally, its structure suggests possible applications in fields such as pharmaceuticals, agrochemicals, or materials science, where derivatives of aromatic aldehydes are often utilized. The compound's stability, reactivity, and potential for further functionalization make it of interest in synthetic organic chemistry. However, specific safety and handling guidelines should be followed, as with all chemical substances, to ensure safe laboratory practices.
Formula:C15H12O3
InChI:InChI=1/C15H12O3/c16-10-12-6-8-14(9-7-12)18-11-15(17)13-4-2-1-3-5-13/h1-10H,11H2
SMILES:c1ccc(cc1)C(=O)COc1ccc(cc1)C=O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-(2-Oxo-2-phenylethoxy)benzaldehyde
CAS:4-(2-Oxo-2-phenylethoxy)benzaldehyde is an aldehyde that is used as a starting material for the synthesis of other chemical compounds. It is prepared from phenylacetaldehyde and acetone in the presence of a nucleophile such as hydrochloric acid. The mechanism for this reaction is postulated to be similar to that of the nitronate reduction, which involves the addition of a nucleophile to form an intermediate iminium salt. This intermediate then reacts with hydrogen gas, yielding 4-(2-oxo-2-phenylethoxy)benzaldehyde. The reaction can also be catalyzed by ruthenium or palladium complexes.Formula:C15H12O3Purity:Min. 95%Molecular weight:240.25 g/mol

