CAS 1394899-06-9

1,1-Dimethylethyl 4-bromo-3-formyl-7-methoxy-1H-indole-1-carboxylate

Description:

1,1-Dimethylethyl 4-bromo-3-formyl-7-methoxy-1H-indole-1-carboxylate, with the CAS number 1394899-06-9, is a chemical compound that belongs to the indole family, characterized by its complex structure featuring an indole ring system. This compound contains several functional groups, including a formyl group, a methoxy group, and a carboxylate ester, which contribute to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the bromine atom introduces halogenation, which can enhance the compound's biological activity or alter its physical properties. The tert-butyl group (1,1-dimethylethyl) is known for providing steric hindrance, which can influence the compound's interactions with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development or as a synthetic intermediate in various chemical reactions. However, specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.

Formula: C₁₅H₁₆BrNO₄

InChI: InChI=1S/C15H16BrNO4/c1-15(2,3)21-14(19)17-7-9(8-18)12-10(16)5-6-11(20-4)13(12)17/h5-8H,1-4H3

InChI key: InChIKey=TWDAERYHKOCHDH-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C=2C(C(C=O)=C1)=C(Br)C=CC2OC

Synonyms:

• 1,1-Dimethylethyl 4-bromo-3-formyl-7-methoxy-1H-indole-1-carboxylate
• 1H-Indole-1-carboxylic acid, 4-bromo-3-formyl-7-methoxy-, 1,1-dimethylethyl ester
• Tert-butyl 4-bromo-3-formyl-7-methoxy-1H-indole-1-carboxylate
• N-Boc-4-bromo-3-formyl-7-methoxyindole

N-Boc-4-bromo-3-formyl-7-methoxyindole

CAS: 1394899-06-9

Purity: 98%

Molecular weight: 354.196

Ref: FT-B14115