CAS 139524-58-6

Phenylmethyl 1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate

Description:

Phenylmethyl 1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate, identified by its CAS number 139524-58-6, is a chemical compound characterized by its unique spirocyclic structure, which includes a bicyclic framework featuring both a dioxane and a piperidine-like moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to the presence of the phenylmethyl group and the spiro structure. It may demonstrate moderate solubility in organic solvents and limited solubility in water, reflecting its hydrophobic characteristics. The presence of functional groups such as esters and nitrogen-containing rings suggests potential reactivity, including hydrolysis and nucleophilic substitution. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural complexity and potential for diverse interactions with biological targets highlight its significance in research contexts. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require empirical determination or literature reference for precise characterization.

Formula: C₁₅H₁₉NO₄

InChI: InChI=1S/C15H19NO4/c17-14(18-12-13-4-2-1-3-5-13)16-8-6-15(7-9-16)19-10-11-20-15/h1-5H,6-12H2

InChI key: InChIKey=FFLQVGSTLGQBGI-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2CCC3(CC2)OCCO3

Synonyms:

• 8-(Benzyloxycarbonyl)-1,4-dioxa-8-azaspiro[4.5]decane
• Phenylmethyl 1,4-dioxa-8-azaspiro[4.5]decane-8-carboxylate
• 1,4-Dioxa-8-azaspiro[4.5]decane-8-carboxylic acid, phenylmethyl ester

8-(BENZYLOXYCARBONYL)-1,4-DIOXA-8-AZASPIRO[4.5]DECANE

CAS: 139524-58-6

Formula: C₁₅H₁₉NO₄

Purity: 95.0%

Molecular weight: 277.32

Ref: 10-F389970