
CAS 139543-40-1
:2-[2-(5-Chloro-1H-indol-3-yl)ethyl]-3-[3-(1-methylethoxy)phenyl]-4(3H)-quinazolinone
Description:
The chemical substance known as 2-[2-(5-Chloro-1H-indol-3-yl)ethyl]-3-[3-(1-methylethoxy)phenyl]-4(3H)-quinazolinone, with the CAS number 139543-40-1, is a synthetic organic compound characterized by its complex molecular structure, which includes an indole moiety and a quinazolinone core. This compound exhibits potential biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure suggests that it may interact with various biological targets, possibly influencing pathways related to cancer or other diseases. The presence of chlorine and ethoxy groups in its structure may enhance its lipophilicity and influence its pharmacokinetic properties. Additionally, the compound's stability, solubility, and reactivity can be affected by its functional groups, which are critical for its biological activity. As with many compounds in this class, further studies are necessary to fully elucidate its mechanism of action, therapeutic potential, and safety profile.
Formula:C27H24ClN3O2
InChI:InChI=1S/C27H24ClN3O2/c1-17(2)33-21-7-5-6-20(15-21)31-26(30-25-9-4-3-8-22(25)27(31)32)13-10-18-16-29-24-12-11-19(28)14-23(18)24/h3-9,11-12,14-17,29H,10,13H2,1-2H3
InChI key:InChIKey=DWDPCGQQNLAFEN-UHFFFAOYSA-N
SMILES:C(CC=1C=2C(NC1)=CC=C(Cl)C2)C=3N(C(=O)C=4C(N3)=CC=CC4)C5=CC(OC(C)C)=CC=C5
Synonyms:- 2-[2-(5-Chloro-1H-indol-3-yl)ethyl]-3-[3-(1-methylethoxy)phenyl]-4(3H)-quinazolinone
- 4(3H)-Quinazolinone, 2-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-[3-(1-methylethoxy)phenyl]-
- LY 202769
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
LY 202769
CAS:LY 202769 is a cholecystokinin-B antagonist.Formula:C27H24ClN3O2Color and Shape:SolidMolecular weight:457.95
