CAS 139549-06-7

2-methoxyquinoline-3-carbaldehyde

Description:

2-Methoxyquinoline-3-carbaldehyde is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a methoxy group (-OCH3) at the second position and an aldehyde group (-CHO) at the third position of the quinoline ring contributes to its unique chemical properties. This compound typically appears as a yellow to brown solid and is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic quinoline structure. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as well as in organic synthesis as an intermediate. The aldehyde functional group allows for further chemical reactivity, enabling various transformations such as condensation reactions. Additionally, 2-methoxyquinoline-3-carbaldehyde may exhibit biological activity, making it of interest in research related to drug discovery and development. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₁H₉NO₂

InChI: InChI=1/C11H9NO2/c1-14-11-9(7-13)6-8-4-2-3-5-10(8)12-11/h2-7H,1H3

SMILES: COc1c(cc2ccccc2n1)C=O

Synonyms:

• 3-Quinolinecarboxaldehyde, 2-Methoxy-

3-Quinolinecarboxaldehyde, 2-methoxy-

CAS: 139549-06-7

Formula: C₁₁H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 187.1947

Ref: IN-DA001B87

2-Methoxyquinoline-3-carbaldehyde

CAS: 139549-06-7

2-Methoxyquinoline-3-carbaldehyde

Purity: 98%

Molecular weight: 187.19g/mol

Ref: 54-OR943652

2-Methoxy-quinoline-3-carbaldehyde

CAS: 139549-06-7

Formula: C₁₁H₉NO₂

Purity: 98%

Molecular weight: 187.198

Ref: 10-F060292

2-Methoxy-quinoline-3-carbaldehyde

CAS: 139549-06-7

2-Methoxy-quinoline-3-carbaldehyde (2MQC) is a novel oxadiazole derivative that has been shown to exhibit good in vitro antimicrobial activity against staphylococcus aureus and typhimurium. 2MQC also has inhibitory properties against the enzyme hepg2, which is involved in the production of reactive oxygen species by neutrophils. 2MQC inhibits the growth of bacteria by binding to their DNA and inhibiting protein synthesis. This compound also has anti-diabetic effects, as it increases glucose uptake and reduces blood sugar levels in mice with high blood sugar levels.

Formula: C₁₁H₉NO₂

Purity: Min. 95%

Molecular weight: 187.19 g/mol

Ref: 3D-PFA54906