CymitQuimica logo

CAS 1395493-15-8

:

Methyl 3-bromo-1,4-dihydro-4-oxo-8-quinolinecarboxylate

Description:
Methyl 3-bromo-1,4-dihydro-4-oxo-8-quinolinecarboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a bromine atom at the 3-position and a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the 1,4-dihydro-4-oxo moiety indicates that it has a ketone functional group, which can participate in various chemical reactions, such as nucleophilic additions. The methyl ester group enhances its solubility in organic solvents, making it suitable for various chemical processes. This compound may exhibit biological activity, which is common among quinoline derivatives, and could be of interest in medicinal chemistry for the development of pharmaceuticals. Its specific properties, such as melting point, boiling point, and spectral characteristics, would typically be determined through experimental methods and are essential for its identification and application in research and industry.
Formula:C11H8BrNO3
InChI:InChI=1S/C11H8BrNO3/c1-16-11(15)7-4-2-3-6-9(7)13-5-8(12)10(6)14/h2-5H,1H3,(H,13,14)
InChI key:InChIKey=UKPPHDNKJCBFJP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(C(=O)C(Br)=CN2)=CC=C1
Synonyms:
  • Methyl 3-bromo-1,4-dihydro-4-oxo-8-quinolinecarboxylate
  • 8-Quinolinecarboxylic acid, 3-bromo-1,4-dihydro-4-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.