CAS 1395493-30-7
:Benzoic acid, 2-amino-4-bromo-5-fluoro-, methyl ester
Description:
Benzoic acid, 2-amino-4-bromo-5-fluoro-, methyl ester, identified by its CAS number 1395493-30-7, is an organic compound characterized by the presence of a benzoic acid moiety modified with amino, bromo, and fluoro substituents. This compound features a methyl ester functional group, which enhances its solubility in organic solvents and may influence its reactivity. The amino group typically imparts basic properties, while the bromo and fluoro substituents can affect the compound's electronic characteristics and steric hindrance, potentially influencing its biological activity and interactions. The presence of halogens like bromine and fluorine often enhances lipophilicity, which can be significant in pharmacological contexts. Additionally, the compound may exhibit interesting properties such as antimicrobial or anti-inflammatory activities, making it of interest in medicinal chemistry. Its synthesis and applications would likely involve standard organic reactions, including esterification and halogenation, and it may serve as a precursor or intermediate in the development of more complex chemical entities.
Formula:C8H7BrFNO2
InChI:InChI=1S/C8H7BrFNO2/c1-13-8(12)4-2-6(10)5(9)3-7(4)11/h2-3H,11H2,1H3
InChI key:InChIKey=OVHIPEYONTVANB-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(N)C=C(Br)C(F)=C1
Synonyms:- Benzoic acid, 2-amino-4-bromo-5-fluoro-, methyl ester
- Methyl 2-amino-4-bromo-5-fluorobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzoic acid, 2-amino-4-bromo-5-fluoro-, methyl ester
CAS:Formula:C8H7BrFNO2Purity:97%Color and Shape:SolidMolecular weight:248.0491Methyl 2-amino-4-bromo-5-fluorobenzoate
CAS:Methyl 2-amino-4-bromo-5-fluorobenzoatePurity:95%Color and Shape:Pale Yellow SolidMolecular weight:248.05g/molMethyl 2-amino-4-bromo-5-fluorobenzoate
CAS:Formula:C8H7BrFNO2Purity:97%Color and Shape:SolidMolecular weight:248.051Methyl 2-amino-4-bromo-5-fluorobenzoate
CAS:Methyl 2-amino-4-bromo-5-fluorobenzoate is a chemical compound that is synthesized by the reaction of sodium nitrite and an acid methyl ester. This product has been shown to be a target product in organic solvents, such as chloroform. Methyl 2-amino-4-bromo-5-fluorobenzoate can be converted to cyanide, which can then react with water to produce hydrocyanic acid. The synthesis of this chemical compound is achieved through the reaction of nitrogen and an acid methyl ester.Formula:C8H7NO2FBrPurity:Min. 95%Molecular weight:248.04 g/mol



