CAS 13958-98-0

3-Bromo-4-cyanopyridine

Description:

3-Bromo-4-cyanopyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 3-position and a cyano group (-C≡N) at the 4-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its moderate solubility in polar organic solvents. It exhibits reactivity typical of halogenated compounds, making it useful in various chemical synthesis applications, particularly in the development of pharmaceuticals and agrochemicals. The cyano group enhances its electrophilic character, allowing for further functionalization. Additionally, 3-bromo-4-cyanopyridine can participate in nucleophilic substitution reactions and is often utilized as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound, as it may pose health risks due to its bromine content and potential toxicity.

Formula: C₆H₃BrN₂

InChI: InChI:1S/C6H3BrN2/c7-6-4-9-2-1-5(6)3-8/h1-2,4H

Synonyms:

• 4-Pyridinecarbonitrile,3-bromo-
• 3-Bromoisonicotinonitrile

3-Bromo-4-cyanopyridine

CAS: 13958-98-0

Formula: C₆H₃BrN₂

Purity: >96.0%(GC)

Color and Shape: White to Gray to Brown powder to crystal

Molecular weight: 183.01

Ref: 3B-B5215

4-Pyridinecarbonitrile, 3-bromo-

CAS: 13958-98-0

Formula: C₆H₃BrN₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 183.0054

Ref: IN-DA001BAX

3-Bromo-4-cyanopyridine

CAS: 13958-98-0

3-Bromo-4-cyanopyridine

Purity: 98%

Molecular weight: 183.01g/mol

Ref: 54-OR310216

3-Bromo-4-cyanopyridine

CAS: 13958-98-0

Formula: C₆H₃BrN₂

Purity: 95%

Color and Shape: Solid, Yellow powder

Molecular weight: 183.008

Ref: 10-F079919