CAS 139585-48-1

2-CHLORO-5-METHOXYPYRIDINE

Description:

2-Chloro-5-methoxypyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chlorine atom at the second position and a methoxy group (-OCH3) at the fifth position of the pyridine ring defines its structure and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its role as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. The chlorine substituent can enhance the compound's reactivity, making it useful in nucleophilic substitution reactions. Additionally, the methoxy group can influence the electronic properties of the molecule, affecting its solubility and interaction with biological targets. 2-Chloro-5-methoxypyridine is generally handled with care due to its potential toxicity and should be stored in a cool, dry place away from incompatible substances.

Formula: C₆H₆ClNO

InChI: InChI=1/C6H6ClNO/c1-9-5-2-3-6(7)8-4-5/h2-4H,1H3

SMILES: COc1ccc(Cl)nc1

Synonyms:

• Pyridine, 2-chloro-5-methoxy- (9CI)

Pyridine, 2-chloro-5-methoxy-

CAS: 139585-48-1

Formula: C₆H₆ClNO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 143.5709

Ref: IN-DA001BBD

2-Chloro-5-methoxypyridine

CAS: 139585-48-1

2-Chloro-5-methoxypyridine

Purity: 98%

Color and Shape: Liquid

Molecular weight: 143.57g/mol

Ref: 54-OR345253

2-Chloro-5-methoxypyridine

CAS: 139585-48-1

Purity: 98%

Molecular weight: 143.571

Ref: FT-Y15335

2-Chloro-5-methoxypyridine

CAS: 139585-48-1

Formula: C₆H₆ClNO

Purity: 95%

Color and Shape: Liquid

Molecular weight: 143.57

Ref: 10-F218360